PRODUCT Properties
| Melting point: | 115° |
| Boiling point: | 502.6±50.0 °C(Predicted) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator, Under Inert Atmosphere |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| pka | pKa 9.0 (Uncertain) |
| form | solid |
| color | Off-White to Brown |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C17H19ClN2OS/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)22(21)17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3 |
| InChIKey | QEPPAOXKZOTMPM-UHFFFAOYSA-N |
| SMILES | [S+]1(c2c(cc(cc2)Cl)N(c3c1cccc3)CCCN(C)C)[O-] |
Description and Uses
Chlorpromazine Sulfoxide is a derivative of Chlorpromazine Hydrochloride (C424750), which is a dopamine antagonist of the typical antipsychotic class of medications possessing additional antiadrenergic, antiserotonergic, anticholinergic and antihistaminergic properties used for schizophrenia treatment.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P330+P331+P310 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 s.c. in mice: 102 mg/kg (Minami, Yoshimoto) |
