LN1389230
100 μg/ml (u = 2%solvent: acetone) , 19666-30-9
CAS NO.:19666-30-9
Empirical Formula: C15H18Cl2N2O3
Molecular Weight: 345.22
MDL number: MFCD00128056
EINECS: 243-215-7
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB158.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-90°C |
| Boiling point: | 417.0±55.0 °C(Predicted) |
| Density | 1.4130 (rough estimate) |
| refractive index | 1.6140 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | -2.73±0.40(Predicted) |
| form | Waxy Solid |
| color | Light yellow to yellow |
| Water Solubility | 0.7mg/L(24 ºC) |
| BRN | 558070 |
| Henry's Law Constant | 1.4×102 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | 1S/C15H18Cl2N2O3/c1-8(2)21-12-7-11(9(16)6-10(12)17)19-14(20)22-13(18-19)15(3,4)5/h6-8H,1-5H3 |
| InChIKey | CHNUNORXWHYHNE-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1cc(N2N=C(OC2=O)C(C)(C)C)c(Cl)cc1Cl |
| CAS DataBase Reference | 19666-30-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Oxadiazon(19666-30-9) |
| EPA Substance Registry System | Oxadiazon (19666-30-9) |
Description and Uses
A commonly used herbicide/pesticide.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | RO0874000 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 19666-30-9(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats, bobwhite quail, mallard duck: 8000, 6000, 1000 mg/kg (Lim) |



