LN1556857
98% , 480452-36-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB4351.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.29±0.1 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 9.46±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChIKey | YJDLJNAWLBVIRF-AEGPPILISA-N |
| SMILES | C(OC(C)(C)C)(=O)N[C@@H]1C[C@@H](C(N(C)C)=O)CC[C@@H]1NC(C(NC1=NC=C(Cl)C=C1)=O)=O |
| LogP | 0.548 |
Description and Uses
(1R, 2S, 5S)-tert-Buty Edoxaban is an impurity of Edoxaban (E555520). Edoxaban is an anticoagulant drug which acts as a direct factor Xa inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H412-H335-H315-H302 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P273-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501 |
| REACH Registrations | Active |





![5-Methyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridine](https://img.chemicalbook.com/CAS/GIF/259809-24-0.gif)
![(1R,2R,4S)-2-[(tert-butoxycarbonyl)aMino]-4-[(diMethylaMino)carbonyl]cyclohexylMethanesulfonate](https://img.chemicalbook.com/CAS/20150408/GIF/929693-31-2.gif)
