PRODUCT Properties
| Melting point: | 130-131 °C |
| Boiling point: | 346.1±17.0 °C(Predicted) |
| Density | 1.329±0.06 g/cm3(Predicted) |
| storage temp. | Amber Vial, -20°C Freezer |
| solubility | Acetone (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.59±0.10(Predicted) |
| color | White to Off-White |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3- |
| InChIKey | NGSWKAQJJWESNS-UTCJRWHESA-N |
| SMILES | C(O)(=O)/C=C\C1=CC=C(O)C=C1 |
| LogP | 1.876 (est) |
| NIST Chemistry Reference | 2-Propenoic acid, 3-(4-hydroxyphenyl)-, (Z)-(4501-31-9) |
Description and Uses
An antioxidative active compound isolated from the EtOAc layer of MeOH extracts of kochujang, Korean fermented red pepper paste. Photoisomerization of ionic liquid ammonium cinnamates. Cinnamic acids upon irradiation in solution undergo geometric isomerization while dimerizing to different dimers in the crystalline state.
