LN1683741
o-Toluenesulfonylisocyanate , 95% , 32324-19-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1088.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 129 °C (5 mmHg) |
| Density | 1.303 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 0-6°C |
| solubility | reacts |
| form | Oil |
| color | Colourless |
| Water Solubility | reacts |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C8H7NO3S/c1-7-4-2-3-5-8(7)13(11,12)9-6-10/h2-5H,1H3 |
| InChIKey | HEBTZZBBPUFAFE-UHFFFAOYSA-N |
| SMILES | C1(S(N=C=O)(=O)=O)=CC=CC=C1C |
| CAS DataBase Reference | 32324-19-9(CAS DataBase Reference) |
Description and Uses
2-Methylbenzenesulfonyl Isocyanate is a reagent in the preparation of chiral hydropyrimidines.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H312-H332-H334 |
| Precautionary statements | P261-P280-P342+P311 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 14-20/21/22-42-36/37/38 |
| Safety Statements | 23-26-27-28-37/39-8-36/37/39 |
| RIDADR | UN 2206 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 2935909099 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Resp. Sens. 1 |








