LN1781941
S-Metolachlor , analyticalstandard , 87392-12-9
Synonym(s):
2-Chloro-N-(2-ethyl-6-methylphenyl)-N-[(1S)-2-methoxy-1-methylethyl]acetamide
CAS NO.:87392-12-9
Empirical Formula: C15H22ClNO2
Molecular Weight: 283.79
MDL number: MFCD04967118
EINECS: 618-004-1
| Pack Size | Price | Stock | Quantity |
| 0.1g | RMB353.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -39.9°C |
| Boiling point: | 282°C (rough estimate) |
| Density | 1.0858 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| Flash point: | 4 °C |
| storage temp. | 0-6°C |
| solubility | Acetic Acid (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| pka | 1.45±0.50(Predicted) |
| color | Colorless to light yellow |
| BRN | 6483536 |
| InChI | InChI=1S/C15H22ClNO2/c1-5-13-8-6-7-11(2)15(13)17(14(18)9-16)12(3)10-19-4/h6-8,12H,5,9-10H2,1-4H3/t12-/m0/s1 |
| InChIKey | WVQBLGZPHOPPFO-LBPRGKRZSA-N |
| SMILES | C(N(C1=C(C)C=CC=C1CC)[C@@H](C)COC)(=O)CCl |
| EPA Substance Registry System | S-Metolachlor (87392-12-9) |
Description and Uses
(S)-Metolachlor is a herbicide and an isomer of metolachlor, which can be used for selective grass weed control, and it can reduce the chemical load to the environment likewise give good efficiency.
Herbicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H410 |
| Precautionary statements | P273-P280-P302+P352 |
| Hazard Codes | Xi,N,Xn,F |
| Risk Statements | 43-50/53-67-65-63-48/20-38-11 |
| Safety Statements | 24-37-60-61-62-36/37 |
| RIDADR | UN 3077 |
| WGK Germany | 2 |





