LN1841839
98% , 101803-03-6
Synonym(s):
N2-Et-dG
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB973.60 | In Stock |
|
| 250mg | RMB1622.40 | In Stock |
|
| 1g | RMB3244.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C |
| solubility | H2O: >5mg/mL |
| form | solid |
| color | white to off-white |
| Water Solubility | H2O: >5mg/mL |
| InChI | 1S/C12H17N5O4/c1-2-13-12-15-10-9(11(20)16-12)14-5-17(10)8-3-6(19)7(4-18)21-8/h5-8,18-19H,2-4H2,1H3,(H2,13,15,16,20)/t6-,7+,8+/m0/s1 |
| InChIKey | VOKQFDULHQUWAV-XLPZGREQSA-N |
| SMILES | CCNC1=Nc2c(ncn2[C@H]3C[C@H](O)[C@@H](CO)O3)C(=O)N1 |
Description and Uses
2'-Deoxy-N-ethylguanosine is a acetaldehyde derived DNA adduct formed in human leukocyte DNA of healthy individuals following alcohol consumption.
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H351-H373 |
| Precautionary statements | P201-P202-P260-P280-P302+P352+P310-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T+ |
| Risk Statements | 26/27/28-33-40 |
| Safety Statements | 36/37/39-45 |
| RIDADR | UN 2811 6.1 / PGI |
| WGK Germany | 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Carc. 2 STOT RE 2 |
