LN1989447
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB368.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >200°C (dec.) |
| Boiling point: | 762.6±60.0 °C(Predicted) |
| Density | 1.63±0.1 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | Methanol (Slightly) |
| pka | 4.50±1.00(Predicted) |
| form | Solid |
| color | Yellow to Dark Orange |
| Stability: | Hygroscopic, Light Sensitive, Temperature Sensitive |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | JBIWCJUYHHGXTC-IPJAVASBSA-N |
| SMILES | C1(=O)[C@]2(O)[C@@]([H])([C@@H](O)[C@@]3([H])C(=C2O)C(=O)C2=C(C=CC=C2O)[C@H]3C)[C@H](N(C)C)C(O)=C1C(N)=O |
Description and Uses
One of the Doxycycline decomposition products.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H361d |
| Precautionary statements | P202-P264-P270-P280-P301+P312-P308+P313 |
| WGK Germany | WGK 3 |
| HS Code | 2924296000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Repr. 2 |








