LN2033441
1-(3-Trifluoromethylphenyl)piperazinehydrochloride , 99% , 16015-69-3
Synonym(s):
3-Trifluoromethylphenylpiperazine hydrochloride;N-[3-(Trifluoromethyl)phenyl]piperazine hydrochloride;TFMPP;TFMPP hydrochloride
CAS NO.：16015-69-3
Empirical Formula: C11H14ClF3N2
Molecular Weight: 266.69
MDL number: MFCD00039033
EINECS: 240-153-2
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 239-241 °C(lit.) |
| Flash point: | 9℃ |
| storage temp. | Refrigerator |
| solubility | methanol:glacial acetic acid (1:1): soluble25mg/mL |
| form | Solid |
| color | White |
| BRN | 8357534 |
| Stability: | Hygroscopic |
| Major Application | forensics and toxicology |
| InChI | 1S/C11H13F3N2.ClH/c12-11(13,14)9-2-1-3-10(8-9)16-6-4-15-5-7-16;/h1-3,8,15H,4-7H2;1H |
| InChIKey | DGNLGWJZZZOYPT-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(ccc1)N2CC[N+H2]CC2.[Cl-] |
| CAS DataBase Reference | 16015-69-3(CAS DataBase Reference) |
Description and Uses
1-(3-Trifluoromethylphenyl)piperazine hydrochloride used as reference materials for forensic laboratories. They affect the central and the autonomic nervous systems, the blood pressure, and smooth muscle.
Safety
| Symbol(GHS) |     GHS07,GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370-H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P210-P260-P280-P301+P310-P311-P261-P305+P351+P338 |
| target organs | Eyes |
| Hazard Codes | Xi,T,F |
| Risk Statements | 36/37/38-39/23/24/25-23/24/25-11 |
| Safety Statements | 26-36-45-36/37-16-7 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
