LN2373541
Telmisartanmethylester , 98% , 528560-93-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB238.40 | In Stock |
|
| 5g | RMB798.40 | In Stock |
|
| 25g | RMB2798.40 | In Stock |
|
| 100g | RMB6996.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-175 ºC |
| Boiling point: | 771.2±70.0 °C(Predicted) |
| Density | 1.20 |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 5.00±0.10(Predicted) |
| color | White to Yellow |
| InChIKey | HJCCZIABCSDUPE-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(CN3C(CCC)=NC4=C(C)C=C(C5N(C)C6=CC=CC=C6N=5)C=C43)C=C2)=CC=CC=C1C(OC)=O |
Description and Uses
An impurity found in Telmisartan (T017000).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |




![Methyl 2-[4-(Bromomethyl)phenyl]benzoate](https://img.chemicalbook.com/CAS/GIF/114772-38-2.gif)
![4'-[(1,7'-Dimethyl-2'-propyl[2,5'-bi-1H-benzimidazol]-1'-yl)methyl][1,1'-biphenyl]-2-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/1026353-20-7.gif)
