95% , 140652-55-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB2665.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 92-93 °C(Solv: chloroform (67-66-3); hexane (110-54-3)) |
| Boiling point: | 535.1±45.0 °C(Predicted) |
| Density | 1.003±0.06 g/cm3(Predicted) |
| pka | 12.51±0.46(Predicted) |
| InChI | InChI=1S/C20H42N4O4/c1-19(2,3)27-17(25)23-15-9-13-21-11-7-8-12-22-14-10-16-24-18(26)28-20(4,5)6/h21-22H,7-16H2,1-6H3,(H,23,25)(H,24,26) |
| InChIKey | KBHLGUZPXGDPGO-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NCCCNCCCCNCCCNC(OC(C)(C)C)=O |
Description and Uses
N1,N12-Di-boc-spermine is a spermine linker containing two a Boc-protected amino groups. The Boc groups can be deprotected under mild acidic conditions to form the free amine. Spermidine is a polyamine that modulates various cellular activities like cellular development and differentiation, stability of DNA, and apoptosis.
N1,N12-Di-boc-spermine is a spermine linker containing two a Boc-protected amino groups. The Boc groups can be deprotected under mild acidic conditions to form the free amine. Spermidine is a polyamine that modulates various cellular activities like cellular development and differentiation, stability of DNA, and apoptosis.