LN2433839
98% , 72126-78-4
Synonym(s):
N,N′-Bis{2-{{{5-[(dimethylamino)methyl]furan-2-yl}methyl}sulfanyl}ethyl}-2-nitroethene-1,1-diamine;N,N′-Bis{2-{{{5-[(dimethylamino)methyl]furan-2-yl}methyl}thio}ethyl}-2-nitro-1,1-ethylenediamine;N,N?-BIS{2-{{{5-[(DIMETHYLAMINO) METHYL]FURAN-2- YL}METHYL}SULFANYL}ETHYL}-2-NITROETHENE-1,1-DIAMINE;Ranitidine Impurity A
CAS NO.:72126-78-4
Empirical Formula: C22H35N5O4S2
Molecular Weight: 497.67
MDL number: MFCD01727377
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB312.00 | In Stock |
|
| 10mg | RMB499.20 | In Stock |
|
| 25mg | RMB936.00 | In Stock |
|
| 50mg | RMB1560.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-62°C |
| Boiling point: | 598.6±50.0 °C(Predicted) |
| Density | 1.206±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol (Slightly) |
| pka | 8.66±0.28(Predicted) |
| color | Light Yellow to Dark Yellow |
| BRN | 5365805 |
| InChI | InChI=1S/C22H35N5O4S2/c1-25(2)13-18-5-7-20(30-18)16-32-11-9-23-22(15-27(28)29)24-10-12-33-17-21-8-6-19(31-21)14-26(3)4/h5-8,15,23-24H,9-14,16-17H2,1-4H3 |
| InChIKey | VTVSRHZKBPARSF-UHFFFAOYSA-N |
| SMILES | C(/NCCSCC1=CC=C(CN(C)C)O1)(\NCCSCC1=CC=C(CN(C)C)O1)=C/[N+]([O-])=O |
Description and Uses
Dimethylaminomethylfurylmethylthioethyl Ranitidine (Ranitidine EP impurity A) is a Ranitidine (R120000) impurity.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H334-H335 |
| Precautionary statements | P261-P280-P284-P304+P340+P312-P333+P313-P342+P311-P304+P340 |
| Hazard Codes | Xn |
| Risk Statements | 37-42/43 |
| Safety Statements | 22-36/37 |
| HS Code | 2932190002 |





![2-[[[5-[(Dimethylamino)methyl]-2-furyl]methyl]thio]ethylamine](https://img.chemicalbook.com/CAS/GIF/66356-53-4.gif)
![2,2'-Methylene Bis[Ranitidine]](https://img.chemicalbook.com/CAS/GIF/207592-21-0.gif)

![N-[2-[5-(DIMETHYLAMINOMETHYL)-2-FURFURYLTHIO]ETHYL]-2-NITRO-ACETAMIDE SODIUM SALT](https://img.chemicalbook.com/CAS/GIF/112251-56-6.gif)