LN2457145
TetrahexylammoniumHydroxide(10%inMethanol) , 17756-56-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB330.40 | In Stock |
|
| 5g | RMB944.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| refractive index | n |
| Flash point: | 11 °C |
| form | clear liquid |
| color | Colorless to Light yellow |
| BRN | 6019685 |
| InChI | 1S/C24H52N.H2O/c1-5-9-13-17-21-25(22-18-14-10-6-2,23-19-15-11-7-3)24-20-16-12-8-4;/h5-24H2,1-4H3;1H2/q+1;/p-1 |
| InChIKey | JCJNUSDBRRKQPC-UHFFFAOYSA-M |
| SMILES | [OH-].CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC |
Description and Uses
Tetrahexylammonium hydroxide is a phase-transfer reagent that can be used:
- To synthesize β-D-xyloside- and β-D-xylobioside-based ionic liquids containing tetrahexylammonium cation.
- As an alkali-free gelling agent to prepare amorphous microporous silica-alumina.
- To synthesize tetrahexylammonium prolinate, a promising candidate to prepare a solid supported ionic liquid phase (SILP) carbon dioxide absorber.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| target organs | Eyes |
| PPE | Faceshields, Gloves, Goggles |
| Hazard Codes | C,T,F |
| Risk Statements | 34-23/25-11-39/23/24/25-23/24/25 |
| Safety Statements | 7-16-24-33-45-36/37/39-27-26 |
| RIDADR | UN 3286 3/PG 2 |
| WGK Germany | 1 |
| F | 9-34 |
| HS Code | 2923.90.0100 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B STOT SE 1 |
