LN2525239
95% , 89073-57-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB248.00 | In Stock |
|
| 10g | RMB413.60 | In Stock |
|
| 25g | RMB828.00 | In Stock |
|
| 100g | RMB2202.40 | In Stock |
|
| 500g | RMB7048.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| Density | 1.3115 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Refrigerator |
| solubility | H2O: 0.43 mg/mL |
| pka | -1.59±0.50(Predicted) |
| form | solid |
| color | white |
| Water Solubility | 1.3g/L(temperature not stated) |
| Stability: | Store tightly sealed at RT; Solutions stable at 4 °C for several days |
| InChI | 1S/C17H20N4O5S/c1-3-9-20-15-13(16(22)21(10-4-2)17(20)23)18-14(19-15)11-5-7-12(8-6-11)27(24,25)26/h5-8H,3-4,9-10H2,1-2H3,(H,18,19)(H,24,25,26) |
| InChIKey | IWALGNIFYOBRKC-UHFFFAOYSA-N |
| SMILES | CCCN1C(=O)N(CCC)c2nc([nH]c2C1=O)-c3ccc(cc3)S(O)(=O)=O |
Description and Uses
Water soluble adenosine receptor antagonist with slight selectivity for A1 receptors.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
