LN2584039
                    95% , 48065-82-3
| Pack Size | Price | Stock | Quantity | 
| 100mg | RMB655.20 | In Stock | 
                                                 | 
                                        
| 250mg | RMB938.40 | In Stock | 
                                                 | 
                                        
| 1g | RMB1876.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Boiling point: | 453.9±45.0 °C(Predicted) | 
                                    
| Density | 1.132±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | 2-8°C, stored under nitrogen | 
                                    
| pka | 2.53±0.24(Predicted) | 
                                    
| Appearance | White to off-white Solid | 
                                    
| optical activity | 2.91°(C=1.00, H2O) | 
                                    
| InChI | InChI=1S/C9H16N2O3/c1-2-8(12)11-6-4-3-5-7(10)9(13)14/h2,7H,1,3-6,10H2,(H,11,12)(H,13,14)/t7-/m0/s1 | 
                                    
| InChIKey | IXKBZVCSFYNRBY-ZETCQYMHSA-N | 
                                    
| SMILES | C(O)(=O)[C@H](CCCCNC(=O)C=C)N | 
                                    
Description and Uses
Nε-acryloyl-L-lysin is a versatile compound that plays a significant role in bioconjugation and polymer chemistry. This amino acid derivative features an acryloyl group, making it an excellent candidate for applications in the synthesis of hydrogels, drug delivery systems, and biomaterials.






