PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Density | 1.537[at 20℃] |
| storage temp. | room temp |
| Colour Index | 61585 |
| form | powder |
| Water Solubility | 10.95g/L at 20℃ |
| λmax | 582 nm 627 nm (2nd) |
| Major Application | diagnostic assay manufacturing hematology histology |
| Cosmetics Ingredients Functions | COLORANT |
| InChIKey | UHXQPQCJDDSMCB-UHFFFAOYSA-L |
| SMILES | [Na+].[Na+].Cc1cc(C)c(c(C)c1Nc2ccc(Nc3c(C)cc(C)c(c3C)S([O-])(=O)=O)c4C(=O)c5ccccc5C(=O)c24)S([O-])(=O)=O |
| LogP | -1.304 at 20℃ |
| EPA Substance Registry System | C.I. Acid Blue 80 (4474-24-2) |
Description and Uses
Acid Blue 80 is a dye/stain. Dyes and metabolites.
