LN2950049
15(R)-17-phenyltrinorProstaglandinF2αethylamide , ≥98% , 1163135-92-9
| Pack Size | Price | Stock | Quantity |
| 500ug | RMB796.80 | In Stock |
|
| 1mg | RMB1596.00 | In Stock |
|
| 5mg | RMB6024.00 | In Stock |
|
| 10mg | RMB10540.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 629.8±55.0 °C(Predicted) |
| Density | 1.145±0.06 g/cm3(Predicted) |
| storage temp. | Amber Vial, -20°C Freezer, Under Inert Atmosphere |
| solubility | Chloroform, (Sparingly), Methanol (Sparingly) |
| form | Gel |
| pka | 14.25±0.20(Predicted) |
| color | Colourless |
| Stability: | Light Sensitive |
| InChIKey | AQOKCDNYWBIDND-ZPFRTTICSA-N |
| SMILES | C(NCC)(=O)CCC/C=C\C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1/C=C/[C@H](O)CCC1=CC=CC=C1 |
Description and Uses
An intermediate in the production of Bimatoprost (B386800).
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS07 |
| Signal word | Danger |
| Hazard statements | H340-H302-H360-H319 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P |








![5-Heptenoic acid, 7-[(1S,2S,3S,5R)-3,5-dihydroxy-2-[(1E,3S)-3-hydroxy-4-[3-(trifluoroMethyl)phenoxy]-1-buten-1-yl]cyclopentyl]-, 1-Methylethyl ester, (5Z)-](https://img.chemicalbook.com/CAS/20150408/GIF/340181-93-3.gif)