LN3005749
SorafenibN-oxide , ≥98% , 583840-03-3
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB1296.00 | In Stock |
|
| 5mg | RMB3788.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-222oC |
| Boiling point: | 591.7±50.0 °C(Predicted) |
| Density | 1.45±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO: soluble; Methanol: very slightly soluble, heated |
| form | A solid |
| pka | 12.89±0.70(Predicted) |
| color | white to off-white |
| biological source | synthetic |
| Major Application | clinical research general analytical life science and biopharma metabolomics |
| InChI | 1S/C21H16ClF3N4O4/c1-26-19(30)18-11-15(8-9-29(18)32)33-14-5-2-12(3-6-14)27-20(31)28-13-4-7-17(22)16(10-13)21(23,24)25/h2-11H,1H3,(H,26,30)(H2,27,28,31) |
| InChIKey | BQAZCCVUZDIZDC-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=[N+](C=CC(=C1)OC2=CC=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F)[O-] |
Description and Uses
A metabolite of Sorafenib, a potent Raf kinase inhibitor.
Safety
| WGK Germany | WGK 3 |
| Storage Class | 10 - Combustible liquids |
