LN3336839
98% , 23145-16-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1272.80 | In Stock |
|
| 5g | RMB3369.60 | In Stock |
|
| 10g | RMB5616.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129 °C |
| Boiling point: | 312.4±22.0 °C(Predicted) |
| Density | 1.676±0.06 g/cm3(Predicted) |
| storage temp. | -20°C, sealed storage, away from moisture |
| form | solid |
| Appearance | Light brown to brown Solid |
| InChI | InChI=1S/C9H5BrO2/c10-7-1-2-9-6(3-7)4-8(5-11)12-9/h1-5H |
| InChIKey | UPEGFMDITWHVHV-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(Br)C=C2C=C1C=O |
| CAS DataBase Reference | 23145-16-6 |
Description and Uses
5-Bromobenzo[b]furan-2-carbaldehyde is used in the synthesis of biscationic, trypanocidal 1-benzofuran compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 22-26-36/37/39 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2932990090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |







