Luffariellolide , ≥98% , 111149-87-2
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB1980.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 541.7±50.0 °C(Predicted) |
| Density | 1.006±0.06 g/cm3(Predicted) |
| solubility | DMSO: soluble; Ethanol: soluble |
| pka | 9.98±0.40(Predicted) |
| form | Pale yellow oil. |
| InChI | InChI=1S/C25H38O3/c1-18(11-7-13-21-17-23(26)28-24(21)27)9-6-10-19(2)14-15-22-20(3)12-8-16-25(22,4)5/h10-11,17,24,27H,6-9,12-16H2,1-5H3/b18-11+,19-10+ |
| InChIKey | JPWPYTMXSXYUPG-QZPYEDBESA-N |
| SMILES | O1C(O)C(CC/C=C(\C)/CC/C=C(\C)/CCC2C(C)(C)CCCC=2C)=CC1=O |
Description and Uses
Luffariellolide is a natural sesterterpenoid which reversibly inhibits secretory phospholipase A2 isoforms from bee venom (IC50 = 230 nM) and snake venom, reducing inflammation. It blocks the production of platelet-activating factor in stimulated neutrophils (IC50 = 5 μM). Luffariellolide is also a structural mimic of all-trans retinoic acid (RA) and, at 1 μM, acts as an agonist for the RA receptors RAR α, β, and γ but not for other nuclear receptors. In RA-sensitive cancer cell lines, luffariellolide induces the expression of RAR target genes and inhibits cell growth. It also inhibits the activation of hypoxia-inducible factor by hypoxia (IC50 = 3.6 μM).[Cayman Chemical]
