PRODUCT Properties
| Density | 1.428±0.06 g/cm3(Predicted) |
| pka | -3.86±0.18(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1S/C7H8O4S/c1-6-2-4-7(5-3-6)11-12(8,9)10/h2-5H,1H3,(H,8,9,10) |
| InChIKey | WGNAKZGUSRVWRH-UHFFFAOYSA-N |
| SMILES | S(O)(OC1=CC=C(C)C=C1)(=O)=O |
Description and Uses
p-Cresyl sulfate (p-Tolyl sulfate) is a uremic toxin, that can cause renal damage and dysfunction. p-Cresyl sulfate shows antiproliferation activity. p-Cresyl sulfate increases the protein expression of HIF-1α and VHL, decreases the protein expression of HIF-2α. p-Cresyl sulfate induces epithelial-mesenchymal transition (EMT). p-Cresyl sulfate activates the JNK and p38 MAPK signaling pathways[1][2][3].