LN3836531
≥95% , 88046-01-9
CAS NO.:88046-01-9
Empirical Formula: C6H11ClN6S2
Molecular Weight: 266.77
MDL number:
EINECS: 618-106-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1080.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >188oC (dec.) |
| storage temp. | Refrigerator |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| PH | 3.89 at 1000g/L |
| InChI | InChI=1S/C6H10N6S2.ClH/c7-4(8)12-6-11-3(2-14-6)1-13-5(9)10;/h2H,1H2,(H3,9,10)(H4,7,8,11,12);1H |
| InChIKey | DMXJVYCDETXZRR-UHFFFAOYSA-N |
| SMILES | N(C1SC=C(CSC(N)=N)N=1)C(N)=N.Cl |
| LogP | 1 at 30℃ and pH3.89 |
Description and Uses
Famotidine intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H412-H302-H332-H402-H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P264-P270-P301+P312-P330-P501-P273-P501-P261-P271-P304+P340-P312 |
| REACH Registrations | Active |







