LN3898549
Spiromesifen , ≥98% , 283594-90-1
Synonym(s):
3-Mesityl-2-oxo-1-oxaspiro[4.4]non-3-en-4-yl) 3,3-dimethylbutyrate
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB1164.00 | In Stock |
|
| 100mg | RMB1884.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98° |
| Boiling point: | 531.1±50.0 °C(Predicted) |
| Density | d20 1.13 |
| storage temp. | 0-6°C |
| solubility | Chloroform: Slightly Soluble,DMSO: Slightly Soluble,Methanol: Slightly Soluble |
| form | Solid |
| color | Off-white to light yellow |
| Major Application | agriculture environmental |
| InChI | 1S/C23H30O4/c1-14-11-15(2)18(16(3)12-14)19-20(26-17(24)13-22(4,5)6)23(27-21(19)25)9-7-8-10-23/h11-12H,7-10,13H2,1-6H3 |
| InChIKey | GOLXNESZZPUPJE-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(c(C)c1)C2=C(OC(=O)CC(C)(C)C)C3(CCCC3)OC2=O |
| EPA Substance Registry System | Butanoic acid, 3,3-dimethyl-, 2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl ester (283594-90-1) |
Description and Uses
Insecticide.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H410 |
| Precautionary statements | P261-P272-P273-P280-P302+P352-P333+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 43-50/53 |
| Safety Statements | 36/37-60-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
| Hazardous Substances Data | 283594-90-1(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): >2500 orally; >2000 dermally (24 hr);; LC50 (4 hr) in rats (mg/m3): >4873 by inhalation (Nauen) |








