PRODUCT Properties
| PH | 4.07(1 mM solution);3.87(10 mM solution);3.72(100 mM solution);3.71(1000 mM solution) |
| InChI | InChI=1S/C6H8O7.H3N/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H3 |
| InChIKey | BWKOZPVPARTQIV-UHFFFAOYSA-N |
| SMILES | C(O)(C(=O)O)(CC(=O)O)CC(=O)O.N |
| CAS DataBase Reference | 4450-94-6 |
| EPA Substance Registry System | 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, monoammonium salt (4450-94-6) |
Description and Uses
AMMONIUM DIHYDROGENCITRATE is used as an analytical reagent, complexing agent, and also in the electronics industry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| TSCA | TSCA listed |
| REACH Registrations | Active |



