LN4088749
Taleranol , ≥98% , 42422-68-4
Synonym(s):
(3S,7S)-3,4,5,6,7,8,9,10,11,12-Decahydro-7,14,16-trihydroxy-3-methyl-1H-2-benzoxacyclotetradecin-1-one solution;2,4-Dihydroxy-6-(6β,10-dihydroxyundecyl)benzoic acid μ-lactone solution;2,4-Dihydroxy-6-(6β,10-dihydroxyundecyl]benzoic acid μ-lactone
CAS NO.：42422-68-4
Empirical Formula: C18H26O5
Molecular Weight: 322.4
MDL number: MFCD00151077
EINECS: 636-982-8
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB512.00 | In Stock |
|
| 5mg | RMB1792.00 | In Stock |
|
| 10mg | RMB2752.00 | In Stock |
|
| 25mg | RMB5740.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134-137°C |
| Boiling point: | 576.0±50.0 °C(Predicted) |
| Density | 1.153±0.06 g/cm3(Predicted) |
| Flash point: | 2℃ |
| storage temp. | 2-8°C |
| solubility | Methanol: 10 mg/ml |
| form | A solid |
| pka | 8.08±0.60(Predicted) |
| color | White to off-white |
| BRN | 4844761 |
| InChI | 1S/C18H26O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h10-12,14,19-21H,2-9H2,1H3/t12-,14-/m0/s1 |
| InChIKey | DWTTZBARDOXEAM-JSGCOSHPSA-N |
| SMILES | C[C@H]1CCC[C@@H](O)CCCCCc2cc(O)cc(O)c2C(=O)O1 |
Description and Uses
Animal growth promotant. Anabolic. Controlled substance.
Safety
| Symbol(GHS) |   GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H361d |
| Precautionary statements | P201-P260-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T,Xn,F |
| Risk Statements | 60-36/37/38-36-20/21/22-11 |
| Safety Statements | 53-36/37/39-45-36/37-16 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 3 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Repr. 2 Skin Corr. 1B |
