LN4165949
Estradiol3-(β-D-Glucuronide)(sodiumsalt) , ≥98% , 14982-12-8
Synonym(s):
1,3,5(10)-Estratriene-3,17β-diol 3-glucuronide;3,17β-Dihydroxy-1,3,5(10)-estratriene 3-glucuronide
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB812.00 | In Stock |
|
| 5mg | RMB3052.00 | In Stock |
|
| 10mg | RMB5692.00 | In Stock |
|
| 25mg | RMB12200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | −20°C |
| solubility | ≤20mg/ml in DMSO;10mg/ml in dimethyl formamide |
| form | crystalline solid |
| Water Solubility | water: 10mg/mL, clear to slightly hazy |
| Stability: | Hygroscopic |
| InChIKey | JKYLXXZHJUQLMK-UHFFFAOYSA-N |
| SMILES | [Na].CC12CCC3C(CCc4cc(OC5OC(C(O)C(O)C5O)C(O)=O)ccc34)C1CCC2O |
Description and Uses
beta-Estradiol 3-(beta-D-glucuronide) sodium salt is a non-cholestatic regioisomer of the estrogen metabolite, estradiol 17-(β-D-glucuronide).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 22-36 |
| WGK Germany | 3 |
| HS Code | 2938909090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |







