LN4301957
BRL54443(maleate) , 1197333-54-2
Synonym(s):
3-(1-Methylpiperidin-4-yl)-1H-indol-5-ol maleate salt
CAS NO.:1197333-54-2
Empirical Formula: C18H22N2O5
Molecular Weight: 346.38
MDL number: MFCD01860866
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB1048.80 | In Stock |
|
| 50mg | RMB4203.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL |
| form | solid |
| color | white |
| Water Solubility | H2O: 50mg/mL |
| InChI | 1S/C14H18N2O.C4H4O4/c1-16-6-4-10(5-7-16)13-9-15-14-3-2-11(17)8-12(13)14;5-3(6)1-2-4(7)8/h2-3,8-10,15,17H,4-7H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | INGCLXPSKXSYND-BTJKTKAUSA-N |
| SMILES | OC(=O)\C=C/C(O)=O.CN1CCC(CC1)c2c[nH]c3ccc(O)cc23 |
Description and Uses
BRL 54443 Maleate Salt can be used in pharmacological activity and biological study of forskolin-free cAMP assay for Gi-coupled receptors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |


