LN4310647
Clethodim , 100μg/mlinmethanol , 99129-21-2
Synonym(s):
2-{(E)-1-[(E)-3-Chloroallyloxyimino]propyl}-5-[2-(ethylthio)propyl]-3-hydroxy-2-cyclohexen-1-one
CAS NO.:99129-21-2
Empirical Formula: C17H26ClNO3S
Molecular Weight: 359.91
MDL number: MFCD01632327
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB280.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <25 °C |
| Boiling point: | 472.6±55.0 °C(Predicted) |
| Density | 1.18±0.1 g/cm3(Predicted) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Sparingly, Sonicated), Ethyl Acetate (Slightly), Methanol (Sparingly |
| form | Liquid |
| pka | 4.28±0.25(Predicted) |
| color | Light Yellow to Dark Yellow |
| Stability: | Hygroscopic |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C17H26ClNO3S/c1-4-14(19-22-8-6-7-18)17-15(20)10-13(11-16(17)21)9-12(3)23-5-2/h6-7,12-13,20H,4-5,8-11H2,1-3H3/b7-6+,19-14 |
| InChIKey | SILSDTWXNBZOGF-JWGBMQLESA-N |
| SMILES | C1(=O)CC(CC(SCC)C)CC(O)=C1C(=NOC/C=C/Cl)CC |
| CAS DataBase Reference | 99129-21-2(CAS DataBase Reference) |
| EPA Substance Registry System | Clethodim (99129-21-2) |
Description and Uses
Systemic graminicide. Post-emergent herbicide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P261-P264-P270-P280-P301+P312-P302+P352 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 22-24/25 |
| RIDADR | UN3082 (environmentally haz- ardous substances, liquid, n. o. s.) |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Skin Sens. 1 |
| Hazardous Substances Data | 99129-21-2(Hazardous Substances Data) |
| Toxicity | LD50 in male, female rats (mg/kg): 1630, 1360 orally; LC50 in trout: 56 mg/l; 8 day feeding in quail: > 6000 ppm (Kincade) |







