LN4371139
97% , 103733-66-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB513.60 | In Stock |
|
| 250mg | RMB856.00 | In Stock |
|
| 1g | RMB1712.80 | In Stock |
|
| 5g | RMB5082.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 434.8±45.0 °C(Predicted) |
| Density | 1.232±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 2.15±0.20(Predicted) |
| InChI | InChI=1S/C12H15NO4/c1-16-10-4-7-3-9(12(14)15)13-6-8(7)5-11(10)17-2/h4-5,9,13H,3,6H2,1-2H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | BWYXEHBJIMGDEB-VIFPVBQESA-N |
| SMILES | C1C2=C(C=C(OC)C(OC)=C2)C[C@@H](C(O)=O)N1 |
| CAS DataBase Reference | 103733-66-0(CAS DataBase Reference) |
Description and Uses
(3S)-1,2,3,4-Tetrahydro-6,7-dimethoxy-3-isoquinolinecarboxylic Acid is a reactant in the preparation of core scaffolds including 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid for direct coagulation factor Xa (FXa) inhibition.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |






