LN4386039
95+% , 1255529-25-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB20477.60 | In Stock |
|
| 250mg | RMB32760.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.43±0.1 g/cm3(Predicted) |
| storage temp. | Store at 0-8 °C |
| pka | 9.46±0.70(Predicted) |
| InChIKey | HGVDHZBSSITLCT-LXZKKBNFSA-N |
| SMILES | C(NC1=NC=C(Cl)C=C1)(=O)C(N[C@@H]1CC[C@H](C(N(C)C)=O)C[C@@H]1NC(C1=NC2CCN(C)CC=2S1)=O)=O |
Description and Uses
N1-(5-chloropyridin-2-yl)-N2-((1R,2S,4S)-4-(dimethylcarbamoyl)-2-(5-methyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridine-2-carboxamido)cyclohexyl)oxalamide is a diastereomer of Edoxaban (E555520), an anticoagulant drug which acts as a direct factor Xa inhibitor. N1-(5-chloropyridin-2-yl)-N2-((1R,2S,4S)-4-(dimethylcarbamoyl)-2-(5-methyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridine-2-carboxamido)cyclohexyl)oxalamide can be used as a pharmceutical standard for detecting impurities in drugs.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |



![(1R,2R,4S)-2-[(tert-butoxycarbonyl)aMino]-4-[(diMethylaMino)carbonyl]cyclohexylMethanesulfonate](https://img.chemicalbook.com/CAS/20150408/GIF/929693-31-2.gif)



