PRODUCT Properties
| Melting point: | 170℃ |
| Boiling point: | 335.63°C (rough estimate) |
| Density | 1.4643 (rough estimate) |
| refractive index | 1.7040 (estimate) |
| storage temp. | 2-8°C, stored under nitrogen, away from moisture |
| pka | 0.73±0.40(Predicted) |
| form | solid |
| form | solid |
| color | white to yellow |
| InChI | InChI=1S/C10H8O4S/c11-9-5-6-10(15(12,13)14)8-4-2-1-3-7(8)9/h1-6,11H,(H,12,13,14) |
| InChIKey | HGWQOFDAUWCQDA-UHFFFAOYSA-N |
| SMILES | C1(S(O)(=O)=O)=C2C(C=CC=C2)=C(O)C=C1 |
| CAS DataBase Reference | 84-87-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Naphthalenesulfonic acid, 4-hydroxy- (84-87-7) |
Description and Uses
1-Naphthol-4-sulfonic acid is used as an intermediate of azo dyes to prepare dyes such as direct copper blue BR and 2R, direct violet RB, acid red B and acid medium jujube red B
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| TSCA | TSCA listed |






