LN4885247
Oxadixyl , 1000μg/mlinmethylbenzene , 77732-09-3
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB208.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-105 °C |
| Boiling point: | 421.12°C (rough estimate) |
| Density | 1.1674 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point: | >100 °C |
| storage temp. | 0-6°C |
| pka | 1.16±0.20(Predicted) |
| Water Solubility | 3.4 mg/L at 25 ºC |
| Merck | 13,6976 |
| BRN | 7098783 |
| Major Application | agriculture environmental |
| InChI | 1S/C14H18N2O4/c1-10-5-4-6-11(2)13(10)16(12(17)9-19-3)15-7-8-20-14(15)18/h4-6H,7-9H2,1-3H3 |
| InChIKey | UWVQIROCRJWDKL-UHFFFAOYSA-N |
| SMILES | COCC(=O)N(N1CCOC1=O)c2c(C)cccc2C |
| LogP | 0.800 |
| CAS DataBase Reference | 77732-09-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetamide, n-(2,6-dimethylphenyl)-2-methoxy-n-(2-oxo-3-oxazolidinyl)-(77732-09-3) |
| EPA Substance Registry System | Oxadixyl (77732-09-3) |
Description and Uses
Oxadixyl is a pesticide residue used for the detection of pesticides in vegetation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312+P330-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| RTECS | AB8131400 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 in female rats (mg/kg): 1860 orally; >2000 dermally (Gisi) |





