PRODUCT Properties
| Melting point: | 164,5-165,5°C |
| Boiling point: | 426.0±40.0 °C(Predicted) |
| Density | 1.14±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethanol (Slightly) |
| pka | 4.88±0.19(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 2981421 |
| Major Application | food and beverages |
| InChI | 1S/C15H22O3/c1-8-4-5-11(6-10(3)15(17)18)13-9(2)7-12(16)14(8)13/h6,8,11-12,14,16H,4-5,7H2,1-3H3,(H,17,18)/b10-6+/t8-,11+,12-,14+/m1/s1 |
| InChIKey | XJNQXTISSHEQKD-UNXUOHHUSA-N |
| SMILES | C[C@@H]1CC[C@@H](\C=C(/C)C(O)=O)C2=C(C)C[C@@H](O)[C@H]12 |
| LogP | 3.293 (est) |
Description and Uses
Hydroxyvalerenic Acid is a constituent of valerian medicinal plant with putative pharmacological properties for the treatment of anxiety and insomnia. Inhibitor of GABAA receptors.
Safety
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
