PRODUCT Properties
| Melting point: | -49.9°C |
| Boiling point: | 147 °C |
| Density | 1.6352 (estimate) |
| Flash point: | 177 °C |
| storage temp. | 0-6°C |
| InChI | InChI=1S/C6H6Cl8O/c7-3(5(9,10)11)1-15-2-4(8)6(12,13)14/h3-4H,1-2H2 |
| InChIKey | LNJXZKBHJZAIKQ-UHFFFAOYSA-N |
| SMILES | O(CC(Cl)C(Cl)(Cl)Cl)CC(Cl)C(Cl)(Cl)Cl |
| CAS DataBase Reference | 127-90-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Propane, 1,1'-oxybis[2,3,3,3-tetrachloro-(127-90-2) |
Description and Uses
Bis(2,3,3,3-tetrachloropropyl) ether is a type of ether compound that is used as a solvent, flame retardant, and plasticizer in various industrial applications.It is also used as a pesticide and fumigant, as well as a component in some transformer oils.
Bis(2,3,3,3-tetrachloropropyl) ether is an effective synergizing agent which is used in pesticide production.
Safety
| WGK Germany | 2 |
| RTECS | KN3600000 |
| Toxicity | LD50 orl-rat: 3630 mg/kg ARSIM* 20,15,66C |



