LN5215147
Cyphenothrin , 97% , 39515-40-7
CAS NO.：39515-40-7
Empirical Formula: C24H25NO3
Molecular Weight: 375.46
MDL number: MFCD01960864
EINECS: 254-484-5
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB296.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25°C |
| Boiling point: | 504.24°C (rough estimate) |
| Density | d2525 1.083 |
| vapor pressure | 1.2×10-4pa 20°C |
| refractive index | 1.5614 (estimate) |
| storage temp. | -20°C |
| solubility | Chloroform, DMSO (Slightly), Methanol (Slightly) |
| Water Solubility | 0.001 mg l-1 (23 °C) |
| Merck | 13,2797 |
| Stability: | Light Sensitive |
| InChI | 1S/C24H25NO3/c1-16(2)13-20-22(24(20,3)4)23(26)28-21(15-25)17-9-8-12-19(14-17)27-18-10-6-5-7-11-18/h5-14,20-22H,1-4H3 |
| InChIKey | FJDPATXIBIBRIM-UHFFFAOYSA-N |
| SMILES | C\C(C)=C\C1C(C(=O)OC(C#N)c2cccc(Oc3ccccc3)c2)C1(C)C |
| CAS DataBase Reference | 39515-40-7(CAS DataBase Reference) |
| EPA Substance Registry System | Cyphenothrin (39515-40-7) |
Description and Uses
Cyphenothrin controls insects in household, public health and industrial situations. It is also used to control insects which attack wood and fabrics.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P264-P270-P273-P301+P312-P391-P501 |
| Hazard Codes | Xn;N,N,Xn |
| Risk Statements | 22-50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 2810 |
| WGK Germany | 3 |
| RTECS | GZ1453500 |
| HS Code | 29269090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 39515-40-7(Hazardous Substances Data) |
