LN5342248
Analysis standard reagent , 98886-44-3
Synonym(s):
O-Ethyl S-(1-methylpropyl) 2-oxo-3-thiazolidinylphosphonothioate;S-sec-Butyl O-ethyl 2-oxo-3-thiazolidinylphosphonothioate
| Pack Size | Price | Stock | Quantity |
| 20mg | RMB3670.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <25 °C |
| Boiling point: | bp0.5 198° |
| Density | 1.26±0.1 g/cm3(Predicted) |
| refractive index | n19.6D 1.5334 |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Water (Slightly) |
| pka | -2?+-.0.20(Predicted) |
| form | <25°C Solid,>25°C Liquid |
| color | White to off-white |
| Stability: | Hygroscopic |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C9H18NO3PS2/c1-4-8(3)16-14(12,13-5-2)10-6-7-15-9(10)11/h8H,4-7H2,1-3H3 |
| InChIKey | DUFVKSUJRWYZQP-UHFFFAOYSA-N |
| SMILES | P(N1CCSC1=O)(SC(C)CC)(=O)OCC |
| CAS DataBase Reference | 98886-44-3(CAS DataBase Reference) |
| EPA Substance Registry System | Fosthiazate (98886-44-3) |
Description and Uses
thiazolidin e thione pharmaceutical intermediate
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H317-H318-H410 |
| Precautionary statements | P273-P280-P301+P310-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,N |
| Risk Statements | 21-23/25-39-41-43-50/53 |
| Safety Statements | 53-25-26-39-45-60-61 |
| RIDADR | UN 2810 |
| WGK Germany | 3 |
| RTECS | TB1707000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29341000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Sens. 1 |
| Hazardous Substances Data | 98886-44-3(Hazardous Substances Data) |
| Toxicity | LD50 in male, female mice, male, female rats (mg/kg): 104, 91, 73, 57 orally; in male, female rats (mg/kg): 2396, 861 dermally. LC50 in male, female rats (mg/l): 0.832, 0.558 by inhalation (Toki). |






