PRODUCT Properties
| Melting point: | 115-120°C |
| Boiling point: | 311.69°C (rough estimate) |
| Density | 1.2822 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| storage temp. | −20°C |
| solubility | Methanol (Slightly), Water |
| pka | 13.31±0.20(Predicted) |
| form | Solid |
| color | Red to Black |
| Stability: | Air Sensitive, Light Sensitive |
| InChI | InChI=1S/C9H9NO3/c1-10-4-9(13)5-2-7(11)8(12)3-6(5)10/h2-3,9,13H,4H2,1H3 |
| InChIKey | RPHLQSHHTJORHI-UHFFFAOYSA-N |
| SMILES | N1(C)C2C(=CC(=O)C(=O)C=2)C(O)C1 |
Description and Uses
The substance mainly responsible for the red colours produced during the mild oxidation of adrenaline
