PRODUCT Properties
| Melting point: | 115-120°C |
| Boiling point: | 311.69°C (rough estimate) |
| Density | 1.2822 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| storage temp. | −20°C |
| solubility | Methanol (Slightly), Water |
| pka | 13.31±0.20(Predicted) |
| form | Solid |
| color | Red to Black |
| Stability: | Air Sensitive, Light Sensitive |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C9H9NO3/c1-10-4-9(13)5-2-7(11)8(12)3-6(5)10/h2-3,9,13H,4H2,1H3 |
| InChIKey | RPHLQSHHTJORHI-UHFFFAOYSA-N |
| SMILES | N1(C)C2C(=CC(=O)C(=O)C=2)C(O)C1 |
Description and Uses
The substance mainly responsible for the red colours produced during the mild oxidation of adrenaline
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | NM1925000 |
| HS Code | 29339980 |
| Storage Class | 11 - Combustible Solids |
