LN5906858
(±)-threo-3-Methylglutamicacid , ≥98% , 63088-04-0
Synonym(s):
(±)-threo-3-Methylglutamic acid;3MG;threo-3-Methylglutamate
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB2240.00 | In Stock |
|
| 50mg | RMB9520.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 329.4±32.0 °C(Predicted) |
| Density | 1.329±0.06 g/cm3(Predicted) |
| storage temp. | Store at RT |
| solubility | H2O: >1.5mg/dL |
| form | powder |
| pka | 2.20±0.10(Predicted) |
| color | white to off-white |
| Water Solubility | H2O: >1.5mg/dL |
| InChI | 1S/C6H11NO4/c1-3(2-4(8)9)5(7)6(10)11/h3,5H,2,7H2,1H3,(H,8,9)(H,10,11)/t3-,5+/m0/s1 |
| InChIKey | FHJNAFIJPFGZRI-WVZVXSGGSA-N |
| SMILES | C[C@@H](CC(O)=O)[C@@H](N)C(O)=O |
Description and Uses
A highly selective and potent agonist for kainate receptors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
