LN6097857
Methyl2-(4-butoxyphenyl)acetate , 29056-06-2
CAS NO.:29056-06-2
Empirical Formula: C13H18O3
Molecular Weight: 222.28
MDL number: MFCD00075839
EINECS: 249-392-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB522.40 | In Stock |
|
| 5g | RMB1740.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 143 °C / 1mmHg |
| Density | 1.04 |
| storage temp. | 2-8°C |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C13H18O3/c1-3-4-9-16-12-7-5-11(6-8-12)10-13(14)15-2/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | IEPLOMKGNGXJAW-UHFFFAOYSA-N |
| SMILES | O(CCCC)c1ccc(cc1)CC(=O)OC |
| CAS DataBase Reference | 29056-06-2 |
Description and Uses
Bufexamac impurity B EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |



