PRODUCT Properties
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | Dichloromethane, Diethylether, Ethyl Acetate, Hexanes |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | 1S/C14H22OS/c1-13(2,3)10-7-9(16)8-11(12(10)15)14(4,5)6/h7-8,15-16H,1-6H3 |
| InChIKey | NFVMNXZFSKGLDR-UHFFFAOYSA-N |
| SMILES | OC(C(C(C)(C)C)=CC(S)=C1)=C1C(C)(C)C |
Description and Uses
A possible inhibitor of DNA-benzo[a]pyrene adducts formation and benzopyrene activation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
