LN663089
Isopropyl Nitrite , >95% , 541-42-4
CAS NO.:541-42-4
Empirical Formula: C3H7NO2
Molecular Weight: 89.09
MDL number: MFCD00043488
EINECS: 208-779-0
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 39℃ |
| Density | 1.02 |
| vapor pressure | 57.595-61.088kPa at 25℃ |
| refractive index | nD20 1.3520 |
| Flash point: | -37℃ |
| InChI | InChI=1S/C3H7NO2/c1-3(2)6-4-5/h3H,1-2H3 |
| InChIKey | SKRDXYBATCVEMS-UHFFFAOYSA-N |
| SMILES | N(=O)OC(C)C |
| LogP | 1.79 |
| EPA Substance Registry System | Nitrous acid, 1-methylethyl ester (541-42-4) |
Description and Uses
Isopropyl nitrite is used in the preparation of heterocyclic amides as RIP1 kinase inhibitors.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() ![]() GHS08,GHS07,GHS02,GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H225-H314-H318-H330-H341-H317 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P210-P233-P240-P241-P242-P243-P280-P303+P361+P353-P370+P378-P403+P235-P501-P260-P271-P284-P304+P340-P310-P320-P403+P233-P405-P501-P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501-P280-P305+P351+P338-P310 |
| Hazard Codes | O,T |
| Risk Statements | 8-11-23/24/25-36/37/38 |
| Safety Statements | 17-26-36/37/39-45 |
| RIDADR | 1992 |
| TSCA | TSCA listed |
| HazardClass | 3.1 |
| PackingGroup | I |











