LN6854240
98% , 76497-39-7
CAS NO.：76497-39-7
Empirical Formula: C6H10O3S
Molecular Weight: 162.21
MDL number: MFCD00038563
EINECS: 278-480-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB152.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 5 °C |
| Boiling point: | 120-132 °C (1 mmHg) |
| alpha | -46 º (c=1, 96% EtOH) |
| Density | 1.178 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Store at 0-5°C |
| solubility | Chloroform (Slightly), Ethanol (Sparingly), Methanol (Slightly) |
| form | liquid |
| pka | 4.22±0.10(Predicted) |
| Water Solubility | INSOLUBLE |
| InChI | InChI=1S/C6H10O3S/c1-4(6(8)9)3-10-5(2)7/h4H,3H2,1-2H3,(H,8,9)/t4-/m1/s1 |
| InChIKey | VFVHNRJEYQGRGE-SCSAIBSYSA-N |
| SMILES | C(O)(=O)[C@H](C)CSC(C)=O |
| CAS DataBase Reference | 76497-39-7(CAS DataBase Reference) |
Description and Uses
S-Acetylthio-2-methylpropionic acid (S-AMPA) is a key chiral intermediate for Captopril (C175750) and other hypertension drugs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | C,T |
| Risk Statements | 34-36-24/25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 29309070 |
