LN6930651
(R,S)-N-Nitrosoanatabine , 98% , 887407-16-1
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB1260.00 | In Stock |
|
| 25MG | RMB4408.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 367.8±42.0 °C(Predicted) |
| Density | 1.22±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator, Under Inert Atmosphere |
| solubility | Chloroform: slightly soluble; Ethyl Acetate: slightly soluble |
| pka | 5.06±0.12(Predicted) |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C10H11N3O/c14-12-13-7-2-1-5-10(13)9-4-3-6-11-8-9/h1-4,6,8,10H,5,7H2 |
| InChIKey | ZJOFAFWTOKDIFH-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CN=C2)N(N=O)CC=CC1 |
Description and Uses
(R,S)-N-Nitroso Anatabine is a metabolite of tobacco, a specific N-nitrosamines. (R,S)-N-Nitroso Anatabine
