LN6969255
95% , 1158891-05-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1344.00 | In Stock |
|
| 250mg | RMB2346.40 | In Stock |
|
| 1g | RMB5364.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Store at0-5°C |
| InChIKey | TURIFBDQLJNYAM-CLOONOSVSA-N |
| SMILES | N4([C@@H](C[C@H](C4)Cc5ccccc5)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
Description and Uses
Fmoc-(2S,4R)-4-benzyl-pyrrolidine-2-carboxylic Acid is used as a reactant in the synthesis of novel dimeric Smac analogs as prospective anticancer agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P301+P312-P362+P364 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |


