PRODUCT Properties
Melting point: | 41-44 °C(lit.) |
Boiling point: | 255 °C(lit.) |
Density | 1.1160 (estimate) |
refractive index | 1.5278 (estimate) |
Flash point: | 187 °F |
storage temp. | Store at room temperature |
Appearance | Colorless to light yellow <41°C Solid,>44°C Liquid |
InChI | InChI=1S/C9H11NO2/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3 |
InChIKey | SCEKDQTVGHRSNS-UHFFFAOYSA-N |
SMILES | C1(C)=CC(C)=CC(C)=C1[N+]([O-])=O |
CAS DataBase Reference | 603-71-4(CAS DataBase Reference) |
EPA Substance Registry System | Benzene, 1,3,5-trimethyl-2-nitro- (603-71-4) |
Description and Uses
2-Nitromesitylene is a substituted nitrobenzene derivative used in medicine and functional healthy food, pharmaceutical compounds comprising substituted nitrobenzene derivatives for prevention and?/or treatment of various diseases.
Safety
Symbol(GHS) | ![]() GHS07 |
Signal word | Warning |
Hazard statements | H312-H335-H302-H315-H332-H319 |
Precautionary statements | P264-P270-P301+P312-P330-P501-P261-P271-P304+P340-P312-P264-P280-P305+P351+P338-P337+P313P-P280-P302+P352-P312-P322-P363-P501-P264-P280-P302+P352-P321-P332+P313-P362 |
Hazard Codes | F,Xn |
Risk Statements | 11-20/21/22-36/37/38 |
Safety Statements | 16-26-36/37/39 |
RIDADR | 1325 |
WGK Germany | 3 |
HazardClass | 4.1 |
PackingGroup | III |