LN7081829
50%solutioninN,N-Dimethylformamide , 68957-94-8
Synonym(s):
1-Propanephosphonic anhydride solution;2,4,6-Tripropyl-1,3,5,2,4,6-trioxatriphosphorinane-2,4,6-trioxide solution;PPACA;T3P
CAS NO.:68957-94-8
Empirical Formula: C9H21O6P3
Molecular Weight: 318.18
MDL number: MFCD00006583
EINECS: 422-210-5
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 65 °C |
| Density | 1.069 g/mL at 25 °C |
| vapor pressure | 0Pa at 25℃ |
| refractive index | n |
| Flash point: | 25 °F |
| storage temp. | Flammables area |
| solubility | Miscible with dioxane, terahydrofuran, dimethyl formamide, polar and aprotic organic solvents. |
| form | Solution |
| color | Clear yellow to brownish |
| Water Solubility | 9.6g/L at 25℃ |
| Sensitive | Moisture Sensitive |
| BRN | 5079255 |
| Exposure limits | ACGIH: TWA 20 ppm (Skin) OSHA: TWA 40 ppm(70 mg/m3) NIOSH: IDLH 137 ppm(25 mg/m3); TWA 20 ppm(34 mg/m3) |
| Stability: | Moisture Sensitive |
| InChI | 1S/C9H21O6P3/c1-4-7-16(10)13-17(11,8-5-2)15-18(12,14-16)9-6-3/h4-9H2,1-3H3 |
| InChIKey | PAQZWJGSJMLPMG-UHFFFAOYSA-N |
| SMILES | CCCP1(=O)OP(=O)(CCC)OP(=O)(CCC)O1 |
| LogP | 0 at 25℃ |
| CAS DataBase Reference | 68957-94-8(CAS DataBase Reference) |
Description and Uses
Propylphosphonic anhydride may be used in the following studies:
- As coupling agent for the synthesis of bispyridine-based ligands, which are used as bridging linkers in multinuclear platinum anticancer drugs.
- Microwave-assissted Fischer indolization of arylhydrazines.
- As acid activating agent for the direct synthesis of acid azides from carboxylic acids.
- One-pot synthesis of coumarins.
- Microwave-mediated synthesis of carbocyclic and heterocyclic fused quinolones.
- One-pot synthesis of 1,2,4-oxadiazoles, 1,3,4-oxadiazoles, and 1,3,4-thiadiazoles from carboxylic acids.
- Activation of the carboxyl group for hydroxyamidation and peptide coupling and in the one-pot conversion of carboxylic acids into hydroxamic acids.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H290-H314-H336 |
| Precautionary statements | P210-P233-P234-P280-P303+P361+P353-P305+P351+P338 |
| target organs | Central nervous system |
| PPE | Faceshields, Gloves, Goggles |
| Hazard Codes | T,C,F |
| Risk Statements | 61-20/21-34-67-66-11 |
| Safety Statements | 53-26-36/37/39-45-33-16 |
| RIDADR | UN 2924 3/PG 3 |
| WGK Germany | 1 |
| RTECS | XS5250000 |
| F | 21 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29319019 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 2 Met. Corr. 1 Skin Corr. 1B Skin Sens. 1 STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






