LN7123452
Lysergol , 99.96% , 602-85-7
CAS NO.:602-85-7
Empirical Formula: C16H18N2O
Molecular Weight: 254.33
MDL number: MFCD00010029
EINECS: 210-024-5
| Pack Size | Price | Stock | Quantity |
| 1mL*10mM(inDMSO) | RMB456.00 | In Stock |
|
| 10mg | RMB744.00 | In Stock |
|
| 25mg | RMB1452.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 248°C |
| Boiling point: | 397.54°C (rough estimate) |
| Density | 1.0398 (rough estimate) |
| refractive index | 1.6240 (estimate) |
| storage temp. | Store at -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly), Pyridine (Slightly) |
| pka | 14.61±0.10(Predicted) |
| form | Solid |
| color | Pale Brown to Light Brown |
| InChI | InChI=1/C16H18N2O/c1-18-8-10(9-19)5-13-12-3-2-4-14-16(12)11(7-17-14)6-15(13)18/h2-5,7,10,15,17,19H,6,8-9H2,1H3/t10-,15-/s3 |
| InChIKey | BIXJFIJYBLJTMK-HFQWXNFCNA-N |
| SMILES | CN1C[C@H](CO)C=C2C3=CC=CC4NC=C(C3=4)C[C@@]12[H] |&1:3,18,r| |
| LogP | 1.760 (est) |
Description and Uses
Lysergol is an ergot alkaloid which when used in combination with antibiotic nalidixic acid, can effectively inhibit Escherichia coli. It also maintains the potential to act on the 5-HT1/2 receptors and at α1-adrenergic receptors thus acting as a neuropsychiatric drug.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H335-H300-H315-H319 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | T+,T |
| Risk Statements | 26/27/28-36/37/38-25 |
| Safety Statements | 26-36/37/39-45-36/37 |
| RIDADR | 1544 |
| HazardClass | 6.1(a) |
| PackingGroup | II |




