LN7324538
295328-72-2
| Pack Size | Price | Stock | Quantity |
| 20mg | RMB9344.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 619.4±55.0 °C(Predicted) |
| Density | 1.183±0.06 g/cm3(Predicted) |
| Flash point: | 130℃ |
| storage temp. | 2-8°C |
| pka | 3.15±0.20(Predicted) |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | WJWHJJCWHNPKTH-MQBSTWLZSA-N |
| SMILES | N1(C(=O)[C@@H](N[C@H](C(OC(C)C)=O)CCC2=CC=CC=C2)C)[C@H](C(O)=O)C[C@]2([H])CCC[C@]12[H] |
Description and Uses
Ramipril Isopropyl Ester (Ramipril EP Impurity B) is an impurity of Ramipril (R111000). Ramipril Impurity B.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360FD |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| WGK Germany | 3 |
| HS Code | 2933997500 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B |



![[2S-[1[R*(R*)],2α,3aβ,6aβ]]-1-[2-[[3-Cyclohexyl-1-(ethoxycarbonyl)propyl]aMino]-1-oxoprop](https://img.chemicalbook.com/CAS/20150408/GIF/99742-35-5.gif)
![(R,R,R)-2-Azabicyclo[3.3.0]octane-3-carboxylic Acid Benzyl Ester Hydrochloride Salt](https://img.chemicalbook.com/CAS/GIF/138877-09-5.gif)

![Ramipril Related Compound A (30 mg) ((2S,3aS,6aS)-1-[(S)2-[[(S)-1-(methoxycarbonyl)-3-phenylpropyl]amino]-1-oxopropyl]-octahydrocyclopenta[b]pyrrole-2-carboxylic acid)](https://img.chemicalbook.com/CAS/20180808/GIF/108313-11-7.gif)