LN7356729
98% , 21732-17-2
CAS NO.:21732-17-2
Empirical Formula: C3H4N4O2
Molecular Weight: 128.09
MDL number: MFCD00038813
EINECS: 244-551-7
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 127-129°C |
| Boiling point: | 381.1±44.0 °C(Predicted) |
| Density | 1.78±0.1 g/cm3(Predicted) |
| solubility | DMSO (Soluble), Methanol (Slightly) |
| pka | 2.67±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C3H4N4O2/c8-3(9)1-7-2-4-5-6-7/h2H,1H2,(H,8,9) |
| InChIKey | GRWAIJBHBCCLGS-UHFFFAOYSA-N |
| SMILES | N1(CC(O)=O)C=NN=N1 |
| CAS DataBase Reference | 21732-17-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Tetrazole-1-acetic acid (21732-17-2) |
Description and Uses
1H-Tetrazole-1-acetic Acid is a compound used in the enzymic synthesis of cefazolin, an antibiotic used for the treatment of bacterial infections.
Safety
| Symbol(GHS) | ![]() ![]() GHS01,GHS07 |
| Signal word | Warning |
| Hazard statements | H204-H315-H319-H335 |
| Precautionary statements | P210-P240-P250-P280-P370+P380-P372-P373-P374-P401-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-2 |
| Safety Statements | 26-36/37/39-60-37-36 |
| RIDADR | 407 |
| HazardClass | IRRITANT |
| Excepted Quantities | Not Permitted as Excepted Quantity |







