LN7443451
Dibutylphthalate-3,4,5,6-d4,98atom%D , 98% , 93952-11-5
Synonym(s):
Di-n-butyl phthalate-d4
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB1231.20 | In Stock |
|
| 100MG | RMB3949.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −35 °C(lit.) |
| Boiling point: | 340 °C(lit.) |
| Density | 1.058 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 340 °F |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Colorless to light yellow |
| InChI | 1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3/i7D,8D,9D,10D |
| InChIKey | DOIRQSBPFJWKBE-ULDPCNCHSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)OCCCC)c(c1[2H])C(=O)OCCCC |
| EPA Substance Registry System | Di-n-butyl phthalate-d4 (93952-11-5) |
| CAS Number Unlabeled | 84-74-2 |
Description and Uses
This product may be used as an analytical standard.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360FD-H410 |
| Precautionary statements | P202-P273-P280-P308+P313-P391-P405 |
| Hazard Codes | T,N |
| Risk Statements | 61-50-62 |
| Safety Statements | 53-45-61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 2 Repr. 1B |






